C19H25FN4O4 — CID 121437786
5-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-2-methoxy-3-oxopropyl]-5-methylimidazolidine-2,4-dione (PubChem CID 121437786) has the molecular formula C19H25FN4O4 and a molecular weight of 392.43 g/mol. Its IUPAC name is 5-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-2-methoxy-3-oxopropyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-2-methoxy-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 121437786 |
| Molecular Formula | C19H25FN4O4 |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.19 |
| IUPAC Name | 5-[3-[(3S)-4-(3-fluorophenyl)-3-methylpiperazin-1-yl]-2-methoxy-3-oxopropyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COC(CC1(C)NC(=O)NC1=O)C(=O)N1CCN(c2cccc(F)c2)[C@@H](C)C1 |
| InChI | InChI=1S/C19H25FN4O4/c1-12-11-23(7-8-24(12)14-6-4-5-13(20)9-14)16(25)15(28-3)10-19(2)17(26)21-18(27)22-19/h4-6,9,12,15H,7-8,10-11H2,1-3H3,(H2,21,22,26,27)/t12-,15?,19?/m0/s1 |
| InChIKey | QMZABDBWNSZVLI-UUZUZFRQSA-N |
| XLogP | 0.87 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|