About 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide
4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide (PubChem CID 121438076) has the molecular formula C12H12N2OS
and a molecular weight of 232.31 g/mol. Its IUPAC name is 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide |
| PubChem CID | 121438076 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide |
| SMILES | CCc1nc(C(N)=O)sc1-c1ccccc1 |
| InChI | InChI=1S/C12H12N2OS/c1-2-9-10(8-6-4-3-5-7-8)16-12(14-9)11(13)15/h3-7H,2H2,1H3,(H2,13,15) |
| InChIKey | DMDSAUMGZBGGPQ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide?
The IUPAC name of 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide (CID 121438076) is 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide?
The canonical SMILES for 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide is CCc1nc(C(N)=O)sc1-c1ccccc1.
What is the InChIKey of 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide?
The InChIKey is DMDSAUMGZBGGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2OS/c1-2-9-10(8-6-4-3-5-7-8)16-12(14-9)11(13)15/h3-7H,2H2,1H3,(H2,13,15).
What are the key properties of 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide?
4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide has a molecular weight of 232.31 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5-phenyl-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 121438076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).