C13H16F3NO2 — CID 121440014
N-hydroxy-2,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide (PubChem CID 121440014) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is N-hydroxy-2,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide.
| Compound Name | N-hydroxy-2,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 121440014 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-hydroxy-2,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide |
| SMILES | CCC(C)(C)C(=O)N(O)Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H16F3NO2/c1-4-13(2,3)12(18)17(19)7-8-5-9(14)6-10(15)11(8)16/h5-6,19H,4,7H2,1-3H3 |
| InChIKey | RRHZFHZAVRUWFD-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|