C13H17F3N2O — CID 121440015
1,3-dimethyl-1-propan-2-yl-3-[(2,3,5-trifluorophenyl)methyl]urea (PubChem CID 121440015) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 1,3-dimethyl-1-propan-2-yl-3-[(2,3,5-trifluorophenyl)methyl]urea.
| Compound Name | 1,3-dimethyl-1-propan-2-yl-3-[(2,3,5-trifluorophenyl)methyl]urea |
|---|---|
| PubChem CID | 121440015 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 1,3-dimethyl-1-propan-2-yl-3-[(2,3,5-trifluorophenyl)methyl]urea |
| SMILES | CC(C)N(C)C(=O)N(C)Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H17F3N2O/c1-8(2)18(4)13(19)17(3)7-9-5-10(14)6-11(15)12(9)16/h5-6,8H,7H2,1-4H3 |
| InChIKey | RWWBZKZDTRIDCO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|