C35H29F8N3O4S — CID 121440449
4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-thiazolidin-3-yl]methyl]-6-(1,1-difluoroethyl)-3-pyridinyl]-6-methoxy-3-pyridinyl]-3,5-dimethylbenzoic acid (PubChem CID 121440449) has the molecular formula C35H29F8N3O4S and a molecular weight of 739.68 g/mol. Its IUPAC name is 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-thiazolidin-3-yl]methyl]-6-(1,1-difluoroethyl)-3-pyridinyl]-6-methoxy-3-pyridinyl]-3,5-dimethylbenzoic acid.
| Compound Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-thiazolidin-3-yl]methyl]-6-(1,1-difluoroethyl)-3-pyridinyl]-6-methoxy-3-pyridinyl]-3,5-dimethylbenzoic acid |
|---|---|
| PubChem CID | 121440449 |
| Molecular Formula | C35H29F8N3O4S |
| Molecular Weight | 739.68 g/mol |
| Exact Mass | 739.18 |
| IUPAC Name | 4-[5-[2-[[(4S,5R)-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-2-oxo-1,3-thiazolidin-3-yl]methyl]-6-(1,1-difluoroethyl)-3-pyridinyl]-6-methoxy-3-pyridinyl]-3,5-dimethylbenzoic acid |
| SMILES | COc1ncc(-c2c(C)cc(C(=O)O)cc2C)cc1-c1ccc(C(C)(F)F)nc1CN1C(=O)S[C@H](c2cc(C(F)(F)F)cc(C(F)(F)F)c2)[C@@H]1C |
| InChI | InChI=1S/C35H29F8N3O4S/c1-16-8-20(31(47)48)9-17(2)28(16)21-12-25(30(50-5)44-14-21)24-6-7-27(33(4,36)37)45-26(24)15-46-18(3)29(51-32(46)49)19-10-22(34(38,39)40)13-23(11-19)35(41,42)43/h6-14,18,29H,15H2,1-5H3,(H,47,48)/t18-,29-/m0/s1 |
| InChIKey | RQJKJZPRVCCMJD-YRVHBCJASA-N |
| XLogP | 10.08 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.68 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|