About (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine
(6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine (PubChem CID 121440973) has the molecular formula C10H10N2
and a molecular weight of 158.20 g/mol. Its IUPAC name is (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine.
Molecular Properties
| Compound Name | (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine |
| PubChem CID | 121440973 |
| Molecular Formula | C10H10N2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.08 |
| IUPAC Name | (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine |
| SMILES | C[C@@H]1C2C=c3cccnc3=NC21 |
| InChI | InChI=1S/C10H10N2/c1-6-8-5-7-3-2-4-11-10(7)12-9(6)8/h2-6,8-9H,1H3/t6-,8?,9?/m1/s1 |
| InChIKey | XNEHBIGXJUJFKT-KXNKJCORSA-N |
| XLogP | 0.13 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine?
The IUPAC name of (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine (CID 121440973) is (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine.
What is the SMILES notation for (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine?
The canonical SMILES for (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine is C[C@@H]1C2C=c3cccnc3=NC21.
What is the InChIKey of (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine?
The InChIKey is XNEHBIGXJUJFKT-KXNKJCORSA-N. The full InChI is InChI=1S/C10H10N2/c1-6-8-5-7-3-2-4-11-10(7)12-9(6)8/h2-6,8-9H,1H3/t6-,8?,9?/m1/s1.
What are the key properties of (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine?
(6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine has a molecular weight of 158.20 g/mol, XLogP of 0.13, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-6-methyl-6,6a-dihydro-5aH-cyclopropa[b][1,8]naphthyridine is sourced from PubChem (CID 121440973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).