About 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine
5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 121441013) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 121441013 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | CC(C)(C)C1=CC2=CC(Br)=CNC2N1 |
| InChI | InChI=1S/C11H15BrN2/c1-11(2,3)9-5-7-4-8(12)6-13-10(7)14-9/h4-6,10,13-14H,1-3H3 |
| InChIKey | AYKHHOIHMPQMTH-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine (CID 121441013) is 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine is CC(C)(C)C1=CC2=CC(Br)=CNC2N1.
What is the InChIKey of 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is AYKHHOIHMPQMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15BrN2/c1-11(2,3)9-5-7-4-8(12)6-13-10(7)14-9/h4-6,10,13-14H,1-3H3.
What are the key properties of 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine?
5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 255.16 g/mol, XLogP of 2.61, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-tert-butyl-7,7a-dihydro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 121441013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).