C21H13F3N6O — CID 121441053
11-[1-[4-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-5-yl]-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene (PubChem CID 121441053) has the molecular formula C21H13F3N6O and a molecular weight of 422.37 g/mol. Its IUPAC name is 11-[1-[4-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-5-yl]-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene.
| Compound Name | 11-[1-[4-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-5-yl]-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene |
|---|---|
| PubChem CID | 121441053 |
| Molecular Formula | C21H13F3N6O |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 11-[1-[4-(trifluoromethyl)phenyl]pyrrolo[2,3-b]pyridin-5-yl]-8-oxa-2,4,6,11-tetrazatricyclo[5.4.1.03,12]dodeca-1,3(12),4,6-tetraene |
| SMILES | FC(F)(F)c1ccc(-n2ccc3cc(N4CCOc5ncnc6c5C4=N6)cnc32)cc1 |
| InChI | InChI=1S/C21H13F3N6O/c22-21(23,24)13-1-3-14(4-2-13)29-6-5-12-9-15(10-25-18(12)29)30-7-8-31-20-16-17(26-11-27-20)28-19(16)30/h1-6,9-11H,7-8H2 |
| InChIKey | SEWSGKBDDWEWGI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 68.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |