C23H20F12O2 — CID 121441136
1,1,1,3,3,3-hexafluoro-2-[5-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dimethylphenyl]methyl]-2,3-dimethylphenyl]propan-2-ol (PubChem CID 121441136) has the molecular formula C23H20F12O2 and a molecular weight of 556.39 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[5-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dimethylphenyl]methyl]-2,3-dimethylphenyl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[5-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dimethylphenyl]methyl]-2,3-dimethylphenyl]propan-2-ol |
|---|---|
| PubChem CID | 121441136 |
| Molecular Formula | C23H20F12O2 |
| Molecular Weight | 556.39 g/mol |
| Exact Mass | 556.13 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[5-[[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)-4,5-dimethylphenyl]methyl]-2,3-dimethylphenyl]propan-2-ol |
| SMILES | Cc1cc(Cc2cc(C)c(C)c(C(O)(C(F)(F)F)C(F)(F)F)c2)cc(C(O)(C(F)(F)F)C(F)(F)F)c1C |
| InChI | InChI=1S/C23H20F12O2/c1-10-5-14(8-16(12(10)3)18(36,20(24,25)26)21(27,28)29)7-15-6-11(2)13(4)17(9-15)19(37,22(30,31)32)23(33,34)35/h5-6,8-9,36-37H,7H2,1-4H3 |
| InChIKey | ZWQAOTTUPSIXEM-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.39 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |