C12H15F4NO6 — CID 121441361
1-(2-prop-2-enoyloxyethylcarbamoyloxy)propan-2-yl 2,3,3,3-tetrafluoropropanoate (PubChem CID 121441361) has the molecular formula C12H15F4NO6 and a molecular weight of 345.25 g/mol. Its IUPAC name is 1-(2-prop-2-enoyloxyethylcarbamoyloxy)propan-2-yl 2,3,3,3-tetrafluoropropanoate.
| Compound Name | 1-(2-prop-2-enoyloxyethylcarbamoyloxy)propan-2-yl 2,3,3,3-tetrafluoropropanoate |
|---|---|
| PubChem CID | 121441361 |
| Molecular Formula | C12H15F4NO6 |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 1-(2-prop-2-enoyloxyethylcarbamoyloxy)propan-2-yl 2,3,3,3-tetrafluoropropanoate |
| SMILES | C=CC(=O)OCCNC(=O)OCC(C)OC(=O)C(F)C(F)(F)F |
| InChI | InChI=1S/C12H15F4NO6/c1-3-8(18)21-5-4-17-11(20)22-6-7(2)23-10(19)9(13)12(14,15)16/h3,7,9H,1,4-6H2,2H3,(H,17,20) |
| InChIKey | RERYWGGVFURIAR-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|