C29H31N2O2P — CID 121442163
bis(2,3-dihydro-1-benzofuran-7-yl)-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phosphane (PubChem CID 121442163) has the molecular formula C29H31N2O2P and a molecular weight of 470.55 g/mol. Its IUPAC name is bis(2,3-dihydro-1-benzofuran-7-yl)-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phosphane.
| Compound Name | bis(2,3-dihydro-1-benzofuran-7-yl)-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phosphane |
|---|---|
| PubChem CID | 121442163 |
| Molecular Formula | C29H31N2O2P |
| Molecular Weight | 470.55 g/mol |
| Exact Mass | 470.21 |
| IUPAC Name | bis(2,3-dihydro-1-benzofuran-7-yl)-[[3-(2,4,6-trimethylphenyl)-2H-imidazol-1-yl]methyl]phosphane |
| SMILES | Cc1cc(C)c(N2C=CN(CP(c3cccc4c3OCC4)c3cccc4c3OCC4)C2)c(C)c1 |
| InChI | InChI=1S/C29H31N2O2P/c1-20-16-21(2)27(22(3)17-20)31-13-12-30(18-31)19-34(25-8-4-6-23-10-14-32-28(23)25)26-9-5-7-24-11-15-33-29(24)26/h4-9,12-13,16-17H,10-11,14-15,18-19H2,1-3H3 |
| InChIKey | MULOZQDLNUWHAO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.55 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|