About 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol
5-ethyl-2,8-dimethylnona-1,8-dien-5-ol (PubChem CID 121442511) has the molecular formula C13H24O
and a molecular weight of 196.33 g/mol. Its IUPAC name is 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol.
Molecular Properties
| Compound Name | 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol |
| PubChem CID | 121442511 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol |
| SMILES | C=C(C)CCC(O)(CC)CCC(=C)C |
| InChI | InChI=1S/C13H24O/c1-6-13(14,9-7-11(2)3)10-8-12(4)5/h14H,2,4,6-10H2,1,3,5H3 |
| InChIKey | WPXMTGDTZOCOPL-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol?
The IUPAC name of 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol (CID 121442511) is 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol.
What is the SMILES notation for 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol?
The canonical SMILES for 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol is C=C(C)CCC(O)(CC)CCC(=C)C.
What is the InChIKey of 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol?
The InChIKey is WPXMTGDTZOCOPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24O/c1-6-13(14,9-7-11(2)3)10-8-12(4)5/h14H,2,4,6-10H2,1,3,5H3.
What are the key properties of 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol?
5-ethyl-2,8-dimethylnona-1,8-dien-5-ol has a molecular weight of 196.33 g/mol, XLogP of 3.84, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,8-dimethylnona-1,8-dien-5-ol is sourced from PubChem (CID 121442511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).