C16H14ClN5OS — CID 121442807
N-(3-chlorophenyl)-3-(1,3-thiazol-4-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide (PubChem CID 121442807) has the molecular formula C16H14ClN5OS and a molecular weight of 359.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)-3-(1,3-thiazol-4-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide.
| Compound Name | N-(3-chlorophenyl)-3-(1,3-thiazol-4-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 121442807 |
| Molecular Formula | C16H14ClN5OS |
| Molecular Weight | 359.84 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | N-(3-chlorophenyl)-3-(1,3-thiazol-4-yl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-5-carboxamide |
| SMILES | O=C(Nc1cccc(Cl)c1)N1CCc2[nH]nc(-c3cscn3)c2C1 |
| InChI | InChI=1S/C16H14ClN5OS/c17-10-2-1-3-11(6-10)19-16(23)22-5-4-13-12(7-22)15(21-20-13)14-8-24-9-18-14/h1-3,6,8-9H,4-5,7H2,(H,19,23)(H,20,21) |
| InChIKey | OHUOUZDBRDFZGF-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.84 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |