C30H21Br2N — CID 121443838
3,5-dibromo-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline (PubChem CID 121443838) has the molecular formula C30H21Br2N and a molecular weight of 555.31 g/mol. Its IUPAC name is 3,5-dibromo-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline.
| Compound Name | 3,5-dibromo-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline |
|---|---|
| PubChem CID | 121443838 |
| Molecular Formula | C30H21Br2N |
| Molecular Weight | 555.31 g/mol |
| Exact Mass | 553.00 |
| IUPAC Name | 3,5-dibromo-N-(3-phenylphenyl)-N-(4-phenylphenyl)aniline |
| SMILES | Brc1cc(Br)cc(N(c2ccc(-c3ccccc3)cc2)c2cccc(-c3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H21Br2N/c31-26-19-27(32)21-30(20-26)33(28-16-14-24(15-17-28)22-8-3-1-4-9-22)29-13-7-12-25(18-29)23-10-5-2-6-11-23/h1-21H |
| InChIKey | KOYZQDDPPVHTTL-UHFFFAOYSA-N |
| XLogP | 10.02 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.31 |
| LogP ≤ 5 | 10.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |