C25H35N8O2P — CID 121443993
4-amino-3-[N'-[3-[(4-aminobenzoyl)amino]phenyl]carbamimidoyl]-N-[(1S)-2-(dimethylamino)-1-phosphanylethyl]-5,5-dimethyl-2H-pyrrole-1-carboxamide (PubChem CID 121443993) has the molecular formula C25H35N8O2P and a molecular weight of 510.58 g/mol. Its IUPAC name is 4-amino-3-[N'-[3-[(4-aminobenzoyl)amino]phenyl]carbamimidoyl]-N-[(1S)-2-(dimethylamino)-1-phosphanylethyl]-5,5-dimethyl-2H-pyrrole-1-carboxamide.
| Compound Name | 4-amino-3-[N'-[3-[(4-aminobenzoyl)amino]phenyl]carbamimidoyl]-N-[(1S)-2-(dimethylamino)-1-phosphanylethyl]-5,5-dimethyl-2H-pyrrole-1-carboxamide |
|---|---|
| PubChem CID | 121443993 |
| Molecular Formula | C25H35N8O2P |
| Molecular Weight | 510.58 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | 4-amino-3-[N'-[3-[(4-aminobenzoyl)amino]phenyl]carbamimidoyl]-N-[(1S)-2-(dimethylamino)-1-phosphanylethyl]-5,5-dimethyl-2H-pyrrole-1-carboxamide |
| SMILES | CN(C)C[C@H](P)NC(=O)N1CC(/C(N)=N/c2cccc(NC(=O)c3ccc(N)cc3)c2)=C(N)C1(C)C |
| InChI | InChI=1S/C25H35N8O2P/c1-25(2)21(27)19(13-33(25)24(35)31-20(36)14-32(3)4)22(28)29-17-6-5-7-18(12-17)30-23(34)15-8-10-16(26)11-9-15/h5-12,20H,13-14,26-27,36H2,1-4H3,(H2,28,29)(H,30,34)(H,31,35)/t20-/m0/s1 |
| InChIKey | RSBXUKAWXGSHMN-FQEVSTJZSA-N |
| XLogP | 2.29 |
| TPSA | 155.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.58 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|