C16H17N3O — CID 121444072
11-ethyl-2,5-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one (PubChem CID 121444072) has the molecular formula C16H17N3O and a molecular weight of 267.33 g/mol. Its IUPAC name is 11-ethyl-2,5-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one.
| Compound Name | 11-ethyl-2,5-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 121444072 |
| Molecular Formula | C16H17N3O |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 11-ethyl-2,5-dimethylpyrido[2,3-b][1,4]benzodiazepin-6-one |
| SMILES | CCN1c2ccccc2C(=O)N(C)c2ccc(C)nc21 |
| InChI | InChI=1S/C16H17N3O/c1-4-19-13-8-6-5-7-12(13)16(20)18(3)14-10-9-11(2)17-15(14)19/h5-10H,4H2,1-3H3 |
| InChIKey | OSWZHLUATFRYFM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |