C16H11NO2 — CID 121444415
15-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,8,10,12-heptaen-10-ylmethyl formate (PubChem CID 121444415) has the molecular formula C16H11NO2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 15-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,8,10,12-heptaen-10-ylmethyl formate.
| Compound Name | 15-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,8,10,12-heptaen-10-ylmethyl formate |
|---|---|
| PubChem CID | 121444415 |
| Molecular Formula | C16H11NO2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | 15-azatetracyclo[6.6.1.02,7.011,15]pentadeca-1(14),2,4,6,8,10,12-heptaen-10-ylmethyl formate |
| SMILES | O=COCc1cc2c3ccccc3c3cccc1n32 |
| InChI | InChI=1S/C16H11NO2/c18-10-19-9-11-8-16-13-5-2-1-4-12(13)15-7-3-6-14(11)17(15)16/h1-8,10H,9H2 |
| InChIKey | QFVDEGMRRNHIEX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|