C15H24N2O — CID 121444554
5-methyl-2-propan-2-yloxy-4-(2,2,6,6-tetradeuteriopiperidin-4-yl)aniline (PubChem CID 121444554) has the molecular formula C15H24N2O and a molecular weight of 252.39 g/mol. Its IUPAC name is 5-methyl-2-propan-2-yloxy-4-(2,2,6,6-tetradeuteriopiperidin-4-yl)aniline.
| Compound Name | 5-methyl-2-propan-2-yloxy-4-(2,2,6,6-tetradeuteriopiperidin-4-yl)aniline |
|---|---|
| PubChem CID | 121444554 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 252.39 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 5-methyl-2-propan-2-yloxy-4-(2,2,6,6-tetradeuteriopiperidin-4-yl)aniline |
| SMILES | [2H]C1([2H])CC(c2cc(OC(C)C)c(N)cc2C)CC([2H])([2H])N1 |
| InChI | InChI=1S/C15H24N2O/c1-10(2)18-15-9-13(11(3)8-14(15)16)12-4-6-17-7-5-12/h8-10,12,17H,4-7,16H2,1-3H3/i6D2,7D2 |
| InChIKey | KOZWCCZKLQFNJK-KXGHAPEVSA-N |
| XLogP | 2.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|