C20H14F6O6S — CID 121444691
3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid (PubChem CID 121444691) has the molecular formula C20H14F6O6S and a molecular weight of 496.38 g/mol. Its IUPAC name is 3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid.
| Compound Name | 3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid |
|---|---|
| PubChem CID | 121444691 |
| Molecular Formula | C20H14F6O6S |
| Molecular Weight | 496.38 g/mol |
| Exact Mass | 496.04 |
| IUPAC Name | 3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc(S(=O)(=O)O)c2cc3ccccc3cc2c1 |
| InChI | InChI=1S/C20H14F6O6S/c21-19(22,23)18(28,20(24,25)26)5-6-32-17(27)14-8-13-7-11-3-1-2-4-12(11)9-15(13)16(10-14)33(29,30)31/h1-4,7-10,28H,5-6H2,(H,29,30,31) |
| InChIKey | RDKPYNMBIHLIOM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.38 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|