C17H11F6NO7S — CID 121444702
5-cyano-7-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid (PubChem CID 121444702) has the molecular formula C17H11F6NO7S and a molecular weight of 487.33 g/mol. Its IUPAC name is 5-cyano-7-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid.
| Compound Name | 5-cyano-7-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 121444702 |
| Molecular Formula | C17H11F6NO7S |
| Molecular Weight | 487.33 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 5-cyano-7-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid |
| SMILES | N#Cc1cc(O)cc2c(S(=O)(=O)O)cc(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)cc12 |
| InChI | InChI=1S/C17H11F6NO7S/c18-16(19,20)15(27,17(21,22)23)1-2-31-14(26)8-4-11-9(7-24)3-10(25)6-12(11)13(5-8)32(28,29)30/h3-6,25,27H,1-2H2,(H,28,29,30) |
| InChIKey | NVOYQGOKJIPYTR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.33 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|