C16H12F6O10S2 — CID 121444703
3-hydroxy-7-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1,5-disulfonic acid (PubChem CID 121444703) has the molecular formula C16H12F6O10S2 and a molecular weight of 542.38 g/mol. Its IUPAC name is 3-hydroxy-7-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1,5-disulfonic acid.
| Compound Name | 3-hydroxy-7-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1,5-disulfonic acid |
|---|---|
| PubChem CID | 121444703 |
| Molecular Formula | C16H12F6O10S2 |
| Molecular Weight | 542.38 g/mol |
| Exact Mass | 541.98 |
| IUPAC Name | 3-hydroxy-7-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1,5-disulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc(S(=O)(=O)O)c2cc(O)cc(S(=O)(=O)O)c2c1 |
| InChI | InChI=1S/C16H12F6O10S2/c17-15(18,19)14(25,16(20,21)22)1-2-32-13(24)7-3-9-10(11(4-7)33(26,27)28)5-8(23)6-12(9)34(29,30)31/h3-6,23,25H,1-2H2,(H,26,27,28)(H,29,30,31) |
| InChIKey | LAMSIOBHEFYFIX-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|