C20H14F6O7S — CID 121444720
6-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid (PubChem CID 121444720) has the molecular formula C20H14F6O7S and a molecular weight of 512.38 g/mol. Its IUPAC name is 6-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid.
| Compound Name | 6-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid |
|---|---|
| PubChem CID | 121444720 |
| Molecular Formula | C20H14F6O7S |
| Molecular Weight | 512.38 g/mol |
| Exact Mass | 512.04 |
| IUPAC Name | 6-hydroxy-3-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-1-sulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc(S(=O)(=O)O)c2cc3ccc(O)cc3cc2c1 |
| InChI | InChI=1S/C20H14F6O7S/c21-19(22,23)18(29,20(24,25)26)3-4-33-17(28)13-6-12-5-11-7-14(27)2-1-10(11)8-15(12)16(9-13)34(30,31)32/h1-2,5-9,27,29H,3-4H2,(H,30,31,32) |
| InChIKey | NUCNMNMAMRABRA-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.38 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|