C20H17F3O6S — CID 121444722
8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid (PubChem CID 121444722) has the molecular formula C20H17F3O6S and a molecular weight of 442.41 g/mol. Its IUPAC name is 8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid.
| Compound Name | 8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid |
|---|---|
| PubChem CID | 121444722 |
| Molecular Formula | C20H17F3O6S |
| Molecular Weight | 442.41 g/mol |
| Exact Mass | 442.07 |
| IUPAC Name | 8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid |
| SMILES | CC(O)(CCOC(=O)c1cccc2c1ccc1cccc(S(=O)(=O)O)c12)C(F)(F)F |
| InChI | InChI=1S/C20H17F3O6S/c1-19(25,20(21,22)23)10-11-29-18(24)15-6-3-5-14-13(15)9-8-12-4-2-7-16(17(12)14)30(26,27)28/h2-9,25H,10-11H2,1H3,(H,26,27,28) |
| InChIKey | BFNQHTYHUJKYGZ-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.41 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|