C20H17F3O7S — CID 121444724
10-hydroxy-8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid (PubChem CID 121444724) has the molecular formula C20H17F3O7S and a molecular weight of 458.41 g/mol. Its IUPAC name is 10-hydroxy-8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid.
| Compound Name | 10-hydroxy-8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid |
|---|---|
| PubChem CID | 121444724 |
| Molecular Formula | C20H17F3O7S |
| Molecular Weight | 458.41 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 10-hydroxy-8-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonylphenanthrene-4-sulfonic acid |
| SMILES | CC(O)(CCOC(=O)c1cccc2c1cc(O)c1cccc(S(=O)(=O)O)c12)C(F)(F)F |
| InChI | InChI=1S/C20H17F3O7S/c1-19(26,20(21,22)23)8-9-30-18(25)12-5-2-4-11-14(12)10-15(24)13-6-3-7-16(17(11)13)31(27,28)29/h2-7,10,24,26H,8-9H2,1H3,(H,27,28,29) |
| InChIKey | OGIRUSASKOBOEJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|