C18H22F4O9S — CID 121444734
3,5-bis[(4,4-difluoro-3-hydroxypentoxy)carbonyl]benzenesulfonic acid (PubChem CID 121444734) has the molecular formula C18H22F4O9S and a molecular weight of 490.42 g/mol. Its IUPAC name is 3,5-bis[(4,4-difluoro-3-hydroxypentoxy)carbonyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[(4,4-difluoro-3-hydroxypentoxy)carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 121444734 |
| Molecular Formula | C18H22F4O9S |
| Molecular Weight | 490.42 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | 3,5-bis[(4,4-difluoro-3-hydroxypentoxy)carbonyl]benzenesulfonic acid |
| SMILES | CC(F)(F)C(O)CCOC(=O)c1cc(C(=O)OCCC(O)C(C)(F)F)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H22F4O9S/c1-17(19,20)13(23)3-5-30-15(25)10-7-11(9-12(8-10)32(27,28)29)16(26)31-6-4-14(24)18(2,21)22/h7-9,13-14,23-24H,3-6H2,1-2H3,(H,27,28,29) |
| InChIKey | NGYYJTISWFDLOI-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.42 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|