C22H16F6O9S2 — CID 121444736
7-(4-sulfophenyl)-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid (PubChem CID 121444736) has the molecular formula C22H16F6O9S2 and a molecular weight of 602.48 g/mol. Its IUPAC name is 7-(4-sulfophenyl)-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid.
| Compound Name | 7-(4-sulfophenyl)-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid |
|---|---|
| PubChem CID | 121444736 |
| Molecular Formula | C22H16F6O9S2 |
| Molecular Weight | 602.48 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | 7-(4-sulfophenyl)-5-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylnaphthalene-1-sulfonic acid |
| SMILES | O=C(OCCC(O)(C(F)(F)F)C(F)(F)F)c1cc(-c2ccc(S(=O)(=O)O)cc2)cc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C22H16F6O9S2/c23-21(24,25)20(30,22(26,27)28)8-9-37-19(29)17-11-13(12-4-6-14(7-5-12)38(31,32)33)10-16-15(17)2-1-3-18(16)39(34,35)36/h1-7,10-11,30H,8-9H2,(H,31,32,33)(H,34,35,36) |
| InChIKey | STGBHGZXVWUCMY-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 155.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|