C26H21F9O9S — CID 121444740
3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonyl-6-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-9-sulfonic acid (PubChem CID 121444740) has the molecular formula C26H21F9O9S and a molecular weight of 680.49 g/mol. Its IUPAC name is 3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonyl-6-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-9-sulfonic acid.
| Compound Name | 3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonyl-6-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-9-sulfonic acid |
|---|---|
| PubChem CID | 121444740 |
| Molecular Formula | C26H21F9O9S |
| Molecular Weight | 680.49 g/mol |
| Exact Mass | 680.08 |
| IUPAC Name | 3-(4,4,4-trifluoro-3-hydroxy-3-methylbutoxy)carbonyl-6-[4,4,4-trifluoro-3-hydroxy-3-(trifluoromethyl)butoxy]carbonylanthracene-9-sulfonic acid |
| SMILES | CC(O)(CCOC(=O)c1ccc2c(S(=O)(=O)O)c3ccc(C(=O)OCCC(O)(C(F)(F)F)C(F)(F)F)cc3cc2c1)C(F)(F)F |
| InChI | InChI=1S/C26H21F9O9S/c1-22(38,24(27,28)29)6-8-43-20(36)13-2-4-17-15(10-13)12-16-11-14(3-5-18(16)19(17)45(40,41)42)21(37)44-9-7-23(39,25(30,31)32)26(33,34)35/h2-5,10-12,38-39H,6-9H2,1H3,(H,40,41,42) |
| InChIKey | MTWOIWUOCMQEMN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.49 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|