C22H25F3O5 — CID 121444809
[(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 2,2,2-trifluoroacetate (PubChem CID 121444809) has the molecular formula C22H25F3O5 and a molecular weight of 426.43 g/mol. Its IUPAC name is [(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 2,2,2-trifluoroacetate.
| Compound Name | [(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 121444809 |
| Molecular Formula | C22H25F3O5 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [(1S,4S,7R,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] 2,2,2-trifluoroacetate |
| SMILES | C=C1C(=O)[C@]23CC[C@H]1CC2[C@@]12CCC[C@@](C)(COC1=O)C2C[C@H]3OC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H25F3O5/c1-11-12-4-7-21(16(11)26)14(8-12)20-6-3-5-19(2,10-29-17(20)27)13(20)9-15(21)30-18(28)22(23,24)25/h12-15H,1,3-10H2,2H3/t12-,13?,14?,15+,19-,20-,21+/m0/s1 |
| InChIKey | MTXASVBOWLIJDS-SRUVVKDWSA-N |
| XLogP | 3.76 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|