C23H32O2 — CID 121444855
(1S,5R,9S,12S)-5,9-diethyl-5-methyl-3,13-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione (PubChem CID 121444855) has the molecular formula C23H32O2 and a molecular weight of 340.51 g/mol. Its IUPAC name is (1S,5R,9S,12S)-5,9-diethyl-5-methyl-3,13-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione.
| Compound Name | (1S,5R,9S,12S)-5,9-diethyl-5-methyl-3,13-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione |
|---|---|
| PubChem CID | 121444855 |
| Molecular Formula | C23H32O2 |
| Molecular Weight | 340.51 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (1S,5R,9S,12S)-5,9-diethyl-5-methyl-3,13-dimethylidenetetracyclo[10.2.2.01,10.04,9]hexadecane-2,14-dione |
| SMILES | C=C1C(=O)[C@@]23CC[C@@H](CC2[C@]2(CC)CCC[C@@](C)(CC)C12)C(=C)C3=O |
| InChI | InChI=1S/C23H32O2/c1-6-21(5)10-8-11-22(7-2)17-13-16-9-12-23(17,19(24)14(16)3)20(25)15(4)18(21)22/h16-18H,3-4,6-13H2,1-2,5H3/t16-,17?,18?,21+,22-,23-/m0/s1 |
| InChIKey | CDRNQYJTOZQQRJ-YAAGXBCTSA-N |
| XLogP | 5.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|