C21H28O6S — CID 121444934
[(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] methanesulfonate (PubChem CID 121444934) has the molecular formula C21H28O6S and a molecular weight of 408.52 g/mol. Its IUPAC name is [(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] methanesulfonate.
| Compound Name | [(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] methanesulfonate |
|---|---|
| PubChem CID | 121444934 |
| Molecular Formula | C21H28O6S |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | [(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] methanesulfonate |
| SMILES | C=C1C(=O)C23CC[C@H]1CC2[C@@]12CCC[C@@](C)(COC1=O)C2C[C@H]3OS(C)(=O)=O |
| InChI | InChI=1S/C21H28O6S/c1-12-13-5-8-21(17(12)22)15(9-13)20-7-4-6-19(2,11-26-18(20)23)14(20)10-16(21)27-28(3,24)25/h13-16H,1,4-11H2,2-3H3/t13-,14?,15?,16+,19-,20-,21?/m0/s1 |
| InChIKey | ANOWQXHFSJFGDV-LOJOHZBBSA-N |
| XLogP | 2.63 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|