C27H32O6S — CID 121444936
[(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] phenylmethanesulfonate (PubChem CID 121444936) has the molecular formula C27H32O6S and a molecular weight of 484.61 g/mol. Its IUPAC name is [(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] phenylmethanesulfonate.
| Compound Name | [(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] phenylmethanesulfonate |
|---|---|
| PubChem CID | 121444936 |
| Molecular Formula | C27H32O6S |
| Molecular Weight | 484.61 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | [(1S,4S,8R,11R)-11-methyl-5-methylidene-6,14-dioxo-13-oxapentacyclo[9.3.3.24,7.01,10.02,7]nonadecan-8-yl] phenylmethanesulfonate |
| SMILES | C=C1C(=O)C23CC[C@H]1CC2[C@@]12CCC[C@@](C)(COC1=O)C2C[C@H]3OS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H32O6S/c1-17-19-9-12-27(23(17)28)21(13-19)26-11-6-10-25(2,16-32-24(26)29)20(26)14-22(27)33-34(30,31)15-18-7-4-3-5-8-18/h3-5,7-8,19-22H,1,6,9-16H2,2H3/t19-,20?,21?,22+,25-,26-,27?/m0/s1 |
| InChIKey | OYOZENSJIYHPFO-ATSWBKLUSA-N |
| XLogP | 4.20 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.61 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|