C22H41N3O4 — CID 121445124
tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylbutanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 121445124) has the molecular formula C22H41N3O4 and a molecular weight of 411.59 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylbutanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylbutanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 121445124 |
| Molecular Formula | C22H41N3O4 |
| Molecular Weight | 411.59 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylbutanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | CC(C)[C@H](C)C(=O)NCC/C=C\CCNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C22H41N3O4/c1-15(2)17(5)19(26)23-13-11-9-10-12-14-24-20(27)18(16(3)4)25-21(28)29-22(6,7)8/h9-10,15-18H,11-14H2,1-8H3,(H,23,26)(H,24,27)(H,25,28)/b10-9-/t17-,18-/m0/s1 |
| InChIKey | BRVOCPGWNBMHQI-WBNOOXNUSA-N |
| XLogP | 3.40 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.59 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|