C24H45N3O4 — CID 121445125
tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylpentanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 121445125) has the molecular formula C24H45N3O4 and a molecular weight of 439.64 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylpentanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylpentanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 121445125 |
| Molecular Formula | C24H45N3O4 |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.34 |
| IUPAC Name | tert-butyl N-[(2S)-1-[[(Z)-6-[[(2S)-2,3-dimethylpentanoyl]amino]hex-3-enyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC(C)[C@H](C)C(=O)NCC/C=C\CCNC(=O)[C@@H](NC(=O)OC(C)(C)C)C(C)CC |
| InChI | InChI=1S/C24H45N3O4/c1-9-17(3)19(5)21(28)25-15-13-11-12-14-16-26-22(29)20(18(4)10-2)27-23(30)31-24(6,7)8/h11-12,17-20H,9-10,13-16H2,1-8H3,(H,25,28)(H,26,29)(H,27,30)/b12-11-/t17?,18?,19-,20-/m0/s1 |
| InChIKey | OJSVZGGSJJQQHN-GMNYVKFESA-N |
| XLogP | 4.18 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|