C17H20ClN5O4 — CID 121445212
5-N-(3-chlorophenyl)-3-N-(2-hydroxyethoxy)-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide (PubChem CID 121445212) has the molecular formula C17H20ClN5O4 and a molecular weight of 393.83 g/mol. Its IUPAC name is 5-N-(3-chlorophenyl)-3-N-(2-hydroxyethoxy)-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(3-chlorophenyl)-3-N-(2-hydroxyethoxy)-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 121445212 |
| Molecular Formula | C17H20ClN5O4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | 5-N-(3-chlorophenyl)-3-N-(2-hydroxyethoxy)-3-N-methyl-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridine-3,5-dicarboxamide |
| SMILES | CN(OCCO)C(=O)c1n[nH]c2c1CN(C(=O)Nc1cccc(Cl)c1)CC2 |
| InChI | InChI=1S/C17H20ClN5O4/c1-22(27-8-7-24)16(25)15-13-10-23(6-5-14(13)20-21-15)17(26)19-12-4-2-3-11(18)9-12/h2-4,9,24H,5-8,10H2,1H3,(H,19,26)(H,20,21) |
| InChIKey | BKSGLBBHTPMRHO-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 110.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|