About 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine
3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine (PubChem CID 121445232) has the molecular formula C18H20FNO3
and a molecular weight of 317.36 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 121445232 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCC(Oc1cccc2c1OCO2)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H20FNO3/c1-20(2)11-10-15(13-6-8-14(19)9-7-13)23-17-5-3-4-16-18(17)22-12-21-16/h3-9,15H,10-12H2,1-2H3 |
| InChIKey | XFCIOLPMKMDDNQ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine (CID 121445232) is 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine is CN(C)CCC(Oc1cccc2c1OCO2)c1ccc(F)cc1.
What is the InChIKey of 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine?
The InChIKey is XFCIOLPMKMDDNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20FNO3/c1-20(2)11-10-15(13-6-8-14(19)9-7-13)23-17-5-3-4-16-18(17)22-12-21-16/h3-9,15H,10-12H2,1-2H3.
What are the key properties of 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine?
3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine has a molecular weight of 317.36 g/mol, XLogP of 3.63, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-benzodioxol-4-yloxy)-3-(4-fluorophenyl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 121445232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).