C17H27F2NO — CID 121446376
1-[(6R)-6-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoro-2,2-dimethylbutan-1-one (PubChem CID 121446376) has the molecular formula C17H27F2NO and a molecular weight of 299.40 g/mol. Its IUPAC name is 1-[(6R)-6-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoro-2,2-dimethylbutan-1-one.
| Compound Name | 1-[(6R)-6-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoro-2,2-dimethylbutan-1-one |
|---|---|
| PubChem CID | 121446376 |
| Molecular Formula | C17H27F2NO |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.21 |
| IUPAC Name | 1-[(6R)-6-cyclohexyl-3,6-dihydro-2H-pyridin-1-yl]-3,3-difluoro-2,2-dimethylbutan-1-one |
| SMILES | CC(F)(F)C(C)(C)C(=O)N1CCC=C[C@H]1C1CCCCC1 |
| InChI | InChI=1S/C17H27F2NO/c1-16(2,17(3,18)19)15(21)20-12-8-7-11-14(20)13-9-5-4-6-10-13/h7,11,13-14H,4-6,8-10,12H2,1-3H3/t14-/m0/s1 |
| InChIKey | YOJIXLPCSODFFT-AWEZNQCLSA-N |
| XLogP | 4.41 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|