About 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one
1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one (PubChem CID 121446402) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one.
Molecular Properties
| Compound Name | 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one |
| PubChem CID | 121446402 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one |
| SMILES | C=CC(C)(C)C(=O)N1C=CC=CC1C1CCCCC1 |
| InChI | InChI=1S/C17H25NO/c1-4-17(2,3)16(19)18-13-9-8-12-15(18)14-10-6-5-7-11-14/h4,8-9,12-15H,1,5-7,10-11H2,2-3H3 |
| InChIKey | VYWJVJKKGPBQQQ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one?
The IUPAC name of 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one (CID 121446402) is 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one.
What is the SMILES notation for 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one?
The canonical SMILES for 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one is C=CC(C)(C)C(=O)N1C=CC=CC1C1CCCCC1.
What is the InChIKey of 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one?
The InChIKey is VYWJVJKKGPBQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25NO/c1-4-17(2,3)16(19)18-13-9-8-12-15(18)14-10-6-5-7-11-14/h4,8-9,12-15H,1,5-7,10-11H2,2-3H3.
What are the key properties of 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one?
1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one has a molecular weight of 259.39 g/mol, XLogP of 4.06, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-cyclohexyl-2H-pyridin-1-yl)-2,2-dimethylbut-3-en-1-one is sourced from PubChem (CID 121446402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).