About (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one
(4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one (PubChem CID 121446472) has the molecular formula C15H19NO2
and a molecular weight of 245.32 g/mol. Its IUPAC name is (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one.
Molecular Properties
| Compound Name | (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one |
| PubChem CID | 121446472 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one |
| SMILES | CCC(C)(C)C(=O)N1C(=O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H19NO2/c1-4-15(2,3)14(18)16-12(10-13(16)17)11-8-6-5-7-9-11/h5-9,12H,4,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | KMPQAQLTXLDQBC-LBPRGKRZSA-N |
| XLogP | 2.92 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one?
The IUPAC name of (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one (CID 121446472) is (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one.
What is the SMILES notation for (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one?
The canonical SMILES for (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one is CCC(C)(C)C(=O)N1C(=O)C[C@H]1c1ccccc1.
What is the InChIKey of (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one?
The InChIKey is KMPQAQLTXLDQBC-LBPRGKRZSA-N. The full InChI is InChI=1S/C15H19NO2/c1-4-15(2,3)14(18)16-12(10-13(16)17)11-8-6-5-7-9-11/h5-9,12H,4,10H2,1-3H3/t12-/m0/s1.
What are the key properties of (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one?
(4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one has a molecular weight of 245.32 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-1-(2,2-dimethylbutanoyl)-4-phenylazetidin-2-one is sourced from PubChem (CID 121446472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).