About 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one
1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one (PubChem CID 121446477) has the molecular formula C16H23NO2
and a molecular weight of 261.37 g/mol. Its IUPAC name is 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one.
Molecular Properties
| Compound Name | 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one |
| PubChem CID | 121446477 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one |
| SMILES | CCC(C)(C)C(=O)N1C[C@H](O)C[C@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23NO2/c1-4-16(2,3)15(19)17-11-13(18)10-14(17)12-8-6-5-7-9-12/h5-9,13-14,18H,4,10-11H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | XEQWFRKZGYCZAP-KGLIPLIRSA-N |
| XLogP | 2.76 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one?
The IUPAC name of 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one (CID 121446477) is 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one.
What is the SMILES notation for 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one?
The canonical SMILES for 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one is CCC(C)(C)C(=O)N1C[C@H](O)C[C@H]1c1ccccc1.
What is the InChIKey of 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one?
The InChIKey is XEQWFRKZGYCZAP-KGLIPLIRSA-N. The full InChI is InChI=1S/C16H23NO2/c1-4-16(2,3)15(19)17-11-13(18)10-14(17)12-8-6-5-7-9-12/h5-9,13-14,18H,4,10-11H2,1-3H3/t13-,14+/m1/s1.
What are the key properties of 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one?
1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one has a molecular weight of 261.37 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4R)-4-hydroxy-2-phenylpyrrolidin-1-yl]-2,2-dimethylbutan-1-one is sourced from PubChem (CID 121446477), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).