About 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid
2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid (PubChem CID 121446514) has the molecular formula C20H23F2N3O3
and a molecular weight of 391.42 g/mol. Its IUPAC name is 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid |
| PubChem CID | 121446514 |
| Molecular Formula | C20H23F2N3O3 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid |
| SMILES | CCCOc1ccnc(-c2cc(F)c(N3CCC(CC(=O)O)CC3)c(F)c2)n1 |
| InChI | InChI=1S/C20H23F2N3O3/c1-2-9-28-17-3-6-23-20(24-17)14-11-15(21)19(16(22)12-14)25-7-4-13(5-8-25)10-18(26)27/h3,6,11-13H,2,4-5,7-10H2,1H3,(H,26,27) |
| InChIKey | ZLUKXYAOZUSXFV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid?
The IUPAC name of 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid (CID 121446514) is 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid is CCCOc1ccnc(-c2cc(F)c(N3CCC(CC(=O)O)CC3)c(F)c2)n1.
What is the InChIKey of 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid?
The InChIKey is ZLUKXYAOZUSXFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H23F2N3O3/c1-2-9-28-17-3-6-23-20(24-17)14-11-15(21)19(16(22)12-14)25-7-4-13(5-8-25)10-18(26)27/h3,6,11-13H,2,4-5,7-10H2,1H3,(H,26,27).
What are the key properties of 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid?
2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid has a molecular weight of 391.42 g/mol, XLogP of 3.90, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2,6-difluoro-4-(4-propoxypyrimidin-2-yl)phenyl]piperidin-4-yl]acetic acid is sourced from PubChem (CID 121446514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).