C14H20FNO — CID 121446659
N-[(2-fluorophenyl)methyl]-N,2,2-trimethylbutanamide (PubChem CID 121446659) has the molecular formula C14H20FNO and a molecular weight of 237.32 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-N,2,2-trimethylbutanamide.
| Compound Name | N-[(2-fluorophenyl)methyl]-N,2,2-trimethylbutanamide |
|---|---|
| PubChem CID | 121446659 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1ccccc1F |
| InChI | InChI=1S/C14H20FNO/c1-5-14(2,3)13(17)16(4)10-11-8-6-7-9-12(11)15/h6-9H,5,10H2,1-4H3 |
| InChIKey | LYPDEADXVSVYJI-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |