About N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide
N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide (PubChem CID 121446739) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide.
Molecular Properties
| Compound Name | N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide |
| PubChem CID | 121446739 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1ccco1 |
| InChI | InChI=1S/C12H19NO2/c1-5-12(2,3)11(14)13(4)9-10-7-6-8-15-10/h6-8H,5,9H2,1-4H3 |
| InChIKey | AZYAYOSYGNRPGG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide?
The IUPAC name of N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide (CID 121446739) is N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide.
What is the SMILES notation for N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide?
The canonical SMILES for N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide is CCC(C)(C)C(=O)N(C)Cc1ccco1.
What is the InChIKey of N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide?
The InChIKey is AZYAYOSYGNRPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO2/c1-5-12(2,3)11(14)13(4)9-10-7-6-8-15-10/h6-8H,5,9H2,1-4H3.
What are the key properties of N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide?
N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide has a molecular weight of 209.29 g/mol, XLogP of 2.67, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(furan-2-ylmethyl)-N,2,2-trimethylbutanamide is sourced from PubChem (CID 121446739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).