C13H16F3NO2 — CID 121446750
2-methoxy-N,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide (PubChem CID 121446750) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is 2-methoxy-N,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide.
| Compound Name | 2-methoxy-N,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 121446750 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | 2-methoxy-N,2-dimethyl-N-[(2,3,5-trifluorophenyl)methyl]propanamide |
| SMILES | COC(C)(C)C(=O)N(C)Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C13H16F3NO2/c1-13(2,19-4)12(18)17(3)7-8-5-9(14)6-10(15)11(8)16/h5-6H,7H2,1-4H3 |
| InChIKey | NDLSAHDYPDJYOP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|