C14H18F3NO2 — CID 121446751
3-methoxy-N,2,2-trimethyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide (PubChem CID 121446751) has the molecular formula C14H18F3NO2 and a molecular weight of 289.30 g/mol. Its IUPAC name is 3-methoxy-N,2,2-trimethyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide.
| Compound Name | 3-methoxy-N,2,2-trimethyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide |
|---|---|
| PubChem CID | 121446751 |
| Molecular Formula | C14H18F3NO2 |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 3-methoxy-N,2,2-trimethyl-N-[(3,4,5-trifluorophenyl)methyl]propanamide |
| SMILES | COCC(C)(C)C(=O)N(C)Cc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C14H18F3NO2/c1-14(2,8-20-4)13(19)18(3)7-9-5-10(15)12(17)11(16)6-9/h5-6H,7-8H2,1-4H3 |
| InChIKey | COXVXQUSYWVLIG-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|