About N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide
N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide (PubChem CID 121446782) has the molecular formula C14H20FNO
and a molecular weight of 237.32 g/mol. Its IUPAC name is N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide.
Molecular Properties
| Compound Name | N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide |
| PubChem CID | 121446782 |
| Molecular Formula | C14H20FNO |
| Molecular Weight | 237.32 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1cccc(F)c1 |
| InChI | InChI=1S/C14H20FNO/c1-5-14(2,3)13(17)16(4)10-11-7-6-8-12(15)9-11/h6-9H,5,10H2,1-4H3 |
| InChIKey | PTHPJJHUJYMDKQ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide?
The IUPAC name of N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide (CID 121446782) is N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide.
What is the SMILES notation for N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide?
The canonical SMILES for N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide is CCC(C)(C)C(=O)N(C)Cc1cccc(F)c1.
What is the InChIKey of N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide?
The InChIKey is PTHPJJHUJYMDKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20FNO/c1-5-14(2,3)13(17)16(4)10-11-7-6-8-12(15)9-11/h6-9H,5,10H2,1-4H3.
What are the key properties of N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide?
N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide has a molecular weight of 237.32 g/mol, XLogP of 3.22, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3-fluorophenyl)methyl]-N,2,2-trimethylbutanamide is sourced from PubChem (CID 121446782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).