C14H19F2NO — CID 121446783
N-[(2,5-difluorophenyl)methyl]-N,2,2-trimethylbutanamide (PubChem CID 121446783) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is N-[(2,5-difluorophenyl)methyl]-N,2,2-trimethylbutanamide.
| Compound Name | N-[(2,5-difluorophenyl)methyl]-N,2,2-trimethylbutanamide |
|---|---|
| PubChem CID | 121446783 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[(2,5-difluorophenyl)methyl]-N,2,2-trimethylbutanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1cc(F)ccc1F |
| InChI | InChI=1S/C14H19F2NO/c1-5-14(2,3)13(18)17(4)9-10-8-11(15)6-7-12(10)16/h6-8H,5,9H2,1-4H3 |
| InChIKey | ODORQPJVMIEQPN-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |