C14H18F3NO — CID 121446847
N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide (PubChem CID 121446847) has the molecular formula C14H18F3NO and a molecular weight of 273.30 g/mol. Its IUPAC name is N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide.
| Compound Name | N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide |
|---|---|
| PubChem CID | 121446847 |
| Molecular Formula | C14H18F3NO |
| Molecular Weight | 273.30 g/mol |
| Exact Mass | 273.13 |
| IUPAC Name | N,2,2-trimethyl-N-[(2,3,5-trifluorophenyl)methyl]butanamide |
| SMILES | CCC(C)(C)C(=O)N(C)Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C14H18F3NO/c1-5-14(2,3)13(19)18(4)8-9-6-10(15)7-11(16)12(9)17/h6-7H,5,8H2,1-4H3 |
| InChIKey | NLVAZOSKQRHRCB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|