About 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one
5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one (PubChem CID 121447331) has the molecular formula C18H16F2N2O3S
and a molecular weight of 378.40 g/mol. Its IUPAC name is 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one |
| PubChem CID | 121447331 |
| Molecular Formula | C18H16F2N2O3S |
| Molecular Weight | 378.40 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one |
| SMILES | CC(C)Sc1cccc(-c2cc(F)c(OCc3cc(=O)[nH]o3)c(F)c2)n1 |
| InChI | InChI=1S/C18H16F2N2O3S/c1-10(2)26-17-5-3-4-15(21-17)11-6-13(19)18(14(20)7-11)24-9-12-8-16(23)22-25-12/h3-8,10H,9H2,1-2H3,(H,22,23) |
| InChIKey | GUALIBQWMHLBJB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.40 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one?
The IUPAC name of 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one (CID 121447331) is 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one is CC(C)Sc1cccc(-c2cc(F)c(OCc3cc(=O)[nH]o3)c(F)c2)n1.
What is the InChIKey of 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one?
The InChIKey is GUALIBQWMHLBJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F2N2O3S/c1-10(2)26-17-5-3-4-15(21-17)11-6-13(19)18(14(20)7-11)24-9-12-8-16(23)22-25-12/h3-8,10H,9H2,1-2H3,(H,22,23).
What are the key properties of 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one?
5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one has a molecular weight of 378.40 g/mol, XLogP of 4.39, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[2,6-difluoro-4-(6-propan-2-ylsulfanyl-2-pyridinyl)phenoxy]methyl]-1,2-oxazol-3-one is sourced from PubChem (CID 121447331), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).