C20H20F3NO3 — CID 121447362
4-[2,6-difluoro-4-(5-fluoro-2,2-dimethyl-1,3-dihydroindol-7-yl)phenoxy]butanoic acid (PubChem CID 121447362) has the molecular formula C20H20F3NO3 and a molecular weight of 379.38 g/mol. Its IUPAC name is 4-[2,6-difluoro-4-(5-fluoro-2,2-dimethyl-1,3-dihydroindol-7-yl)phenoxy]butanoic acid.
| Compound Name | 4-[2,6-difluoro-4-(5-fluoro-2,2-dimethyl-1,3-dihydroindol-7-yl)phenoxy]butanoic acid |
|---|---|
| PubChem CID | 121447362 |
| Molecular Formula | C20H20F3NO3 |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 4-[2,6-difluoro-4-(5-fluoro-2,2-dimethyl-1,3-dihydroindol-7-yl)phenoxy]butanoic acid |
| SMILES | CC1(C)Cc2cc(F)cc(-c3cc(F)c(OCCCC(=O)O)c(F)c3)c2N1 |
| InChI | InChI=1S/C20H20F3NO3/c1-20(2)10-12-6-13(21)9-14(18(12)24-20)11-7-15(22)19(16(23)8-11)27-5-3-4-17(25)26/h6-9,24H,3-5,10H2,1-2H3,(H,25,26) |
| InChIKey | DSDPYBUNRNPENH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|