C18H18F8O9S — CID 121447817
3,5-bis[[4,4,4-trifluoro-3-(fluoromethyl)-3-hydroxybutoxy]carbonyl]benzenesulfonic acid (PubChem CID 121447817) has the molecular formula C18H18F8O9S and a molecular weight of 562.38 g/mol. Its IUPAC name is 3,5-bis[[4,4,4-trifluoro-3-(fluoromethyl)-3-hydroxybutoxy]carbonyl]benzenesulfonic acid.
| Compound Name | 3,5-bis[[4,4,4-trifluoro-3-(fluoromethyl)-3-hydroxybutoxy]carbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 121447817 |
| Molecular Formula | C18H18F8O9S |
| Molecular Weight | 562.38 g/mol |
| Exact Mass | 562.05 |
| IUPAC Name | 3,5-bis[[4,4,4-trifluoro-3-(fluoromethyl)-3-hydroxybutoxy]carbonyl]benzenesulfonic acid |
| SMILES | O=C(OCCC(O)(CF)C(F)(F)F)c1cc(C(=O)OCCC(O)(CF)C(F)(F)F)cc(S(=O)(=O)O)c1 |
| InChI | InChI=1S/C18H18F8O9S/c19-8-15(29,17(21,22)23)1-3-34-13(27)10-5-11(7-12(6-10)36(31,32)33)14(28)35-4-2-16(30,9-20)18(24,25)26/h5-7,29-30H,1-4,8-9H2,(H,31,32,33) |
| InChIKey | FGKQPZAVFICRHN-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 147.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.38 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|